C12H25N3 — CID 83025110
1-(2,6-dimethylpiperidin-1-yl)piperidin-3-amine (PubChem CID 83025110) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)piperidin-3-amine.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 83025110 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)piperidin-3-amine |
| SMILES | CC1CCCC(C)N1N1CCCC(N)C1 |
| InChI | InChI=1S/C12H25N3/c1-10-5-3-6-11(2)15(10)14-8-4-7-12(13)9-14/h10-12H,3-9,13H2,1-2H3 |
| InChIKey | CLIFUWKNYQJQLR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |