C14H22ClN3O — CID 83028527
6-chloro-N-(2,2-dimethyloxan-4-yl)-5-propylpyrimidin-4-amine (PubChem CID 83028527) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 6-chloro-N-(2,2-dimethyloxan-4-yl)-5-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2,2-dimethyloxan-4-yl)-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83028527 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 6-chloro-N-(2,2-dimethyloxan-4-yl)-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(Cl)ncnc1NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H22ClN3O/c1-4-5-11-12(15)16-9-17-13(11)18-10-6-7-19-14(2,3)8-10/h9-10H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | BPPFXSRQFDWXBE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |