C16H20N2O2 — CID 83029387
3-[(2,2-dimethyloxan-4-yl)amino]-2H-isoquinolin-1-one (PubChem CID 83029387) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[(2,2-dimethyloxan-4-yl)amino]-2H-isoquinolin-1-one.
| Compound Name | 3-[(2,2-dimethyloxan-4-yl)amino]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 83029387 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-[(2,2-dimethyloxan-4-yl)amino]-2H-isoquinolin-1-one |
| SMILES | CC1(C)CC(Nc2cc3ccccc3c(=O)[nH]2)CCO1 |
| InChI | InChI=1S/C16H20N2O2/c1-16(2)10-12(7-8-20-16)17-14-9-11-5-3-4-6-13(11)15(19)18-14/h3-6,9,12H,7-8,10H2,1-2H3,(H2,17,18,19) |
| InChIKey | DXRKTSSSNWDWOW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |