C13H19N5O2 — CID 83031271
N-(diaminomethylidene)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 83031271) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(diaminomethylidene)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-(diaminomethylidene)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 83031271 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(diaminomethylidene)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C13H19N5O2/c1-19-10-5-8-3-4-18(13(16)17-12(14)15)7-9(8)6-11(10)20-2/h5-6H,3-4,7H2,1-2H3,(H5,14,15,16,17) |
| InChIKey | UETDTINHPFLEMD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|