C6H10F3NO2 — CID 83031574
3,3,3-trifluoro-N-[(2R)-2-hydroxypropyl]propanamide (PubChem CID 83031574) has the molecular formula C6H10F3NO2 and a molecular weight of 185.14 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(2R)-2-hydroxypropyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[(2R)-2-hydroxypropyl]propanamide |
|---|---|
| PubChem CID | 83031574 |
| Molecular Formula | C6H10F3NO2 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3,3,3-trifluoro-N-[(2R)-2-hydroxypropyl]propanamide |
| SMILES | C[C@@H](O)CNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2/c1-4(11)3-10-5(12)2-6(7,8)9/h4,11H,2-3H2,1H3,(H,10,12)/t4-/m1/s1 |
| InChIKey | AMPWLASXDQHZMV-SCSAIBSYSA-N |
| XLogP | 0.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |