C10H21N5O — CID 83032115
N-(diaminomethylidene)-3-propoxypiperidine-1-carboximidamide (PubChem CID 83032115) has the molecular formula C10H21N5O and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-propoxypiperidine-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-3-propoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 83032115 |
| Molecular Formula | C10H21N5O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-(diaminomethylidene)-3-propoxypiperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCCC(OCCC)C1 |
| InChI | InChI=1S/C10H21N5O/c1-2-6-16-8-4-3-5-15(7-8)10(13)14-9(11)12/h8H,2-7H2,1H3,(H5,11,12,13,14) |
| InChIKey | YXWHUHDMNFPOPG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|