C11H22FNO — CID 83032755
2,2-diethyl-N-(2-fluoroethyl)oxan-4-amine (PubChem CID 83032755) has the molecular formula C11H22FNO and a molecular weight of 203.30 g/mol. Its IUPAC name is 2,2-diethyl-N-(2-fluoroethyl)oxan-4-amine.
| Compound Name | 2,2-diethyl-N-(2-fluoroethyl)oxan-4-amine |
|---|---|
| PubChem CID | 83032755 |
| Molecular Formula | C11H22FNO |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2,2-diethyl-N-(2-fluoroethyl)oxan-4-amine |
| SMILES | CCC1(CC)CC(NCCF)CCO1 |
| InChI | InChI=1S/C11H22FNO/c1-3-11(4-2)9-10(5-8-14-11)13-7-6-12/h10,13H,3-9H2,1-2H3 |
| InChIKey | CIMZLORRMYRDNZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |