C12H23N3O3 — CID 83032833
N-carbamoyl-2-[(2,2-diethyloxan-4-yl)amino]acetamide (PubChem CID 83032833) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-carbamoyl-2-[(2,2-diethyloxan-4-yl)amino]acetamide.
| Compound Name | N-carbamoyl-2-[(2,2-diethyloxan-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 83032833 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-carbamoyl-2-[(2,2-diethyloxan-4-yl)amino]acetamide |
| SMILES | CCC1(CC)CC(NCC(=O)NC(N)=O)CCO1 |
| InChI | InChI=1S/C12H23N3O3/c1-3-12(4-2)7-9(5-6-18-12)14-8-10(16)15-11(13)17/h9,14H,3-8H2,1-2H3,(H3,13,15,16,17) |
| InChIKey | PFCQJWOXUAVFNP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |