C14H25N3O — CID 83032997
2,2-diethyl-N-(2-pyrazol-1-ylethyl)oxan-4-amine (PubChem CID 83032997) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2,2-diethyl-N-(2-pyrazol-1-ylethyl)oxan-4-amine.
| Compound Name | 2,2-diethyl-N-(2-pyrazol-1-ylethyl)oxan-4-amine |
|---|---|
| PubChem CID | 83032997 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2,2-diethyl-N-(2-pyrazol-1-ylethyl)oxan-4-amine |
| SMILES | CCC1(CC)CC(NCCn2cccn2)CCO1 |
| InChI | InChI=1S/C14H25N3O/c1-3-14(4-2)12-13(6-11-18-14)15-8-10-17-9-5-7-16-17/h5,7,9,13,15H,3-4,6,8,10-12H2,1-2H3 |
| InChIKey | PUHLSTMUCXJAHF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |