C15H27N3O — CID 83033681
2,2-diethyl-N-(3-imidazol-1-ylpropyl)oxan-4-amine (PubChem CID 83033681) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2,2-diethyl-N-(3-imidazol-1-ylpropyl)oxan-4-amine.
| Compound Name | 2,2-diethyl-N-(3-imidazol-1-ylpropyl)oxan-4-amine |
|---|---|
| PubChem CID | 83033681 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2,2-diethyl-N-(3-imidazol-1-ylpropyl)oxan-4-amine |
| SMILES | CCC1(CC)CC(NCCCn2ccnc2)CCO1 |
| InChI | InChI=1S/C15H27N3O/c1-3-15(4-2)12-14(6-11-19-15)17-7-5-9-18-10-8-16-13-18/h8,10,13-14,17H,3-7,9,11-12H2,1-2H3 |
| InChIKey | LDCSFUUIPNFKRC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|