About 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione
1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione (PubChem CID 83033573) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione |
| PubChem CID | 83033573 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CCC(C)N1C(=O)CC(NC2CCOC(C)(C)C2)C1=O |
| InChI | InChI=1S/C15H26N2O3/c1-5-10(2)17-13(18)8-12(14(17)19)16-11-6-7-20-15(3,4)9-11/h10-12,16H,5-9H2,1-4H3 |
| InChIKey | UXRGWGIIWGGQHC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione?
The IUPAC name of 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione (CID 83033573) is 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione.
What is the SMILES notation for 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione?
The canonical SMILES for 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione is CCC(C)N1C(=O)CC(NC2CCOC(C)(C)C2)C1=O.
What is the InChIKey of 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione?
The InChIKey is UXRGWGIIWGGQHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-5-10(2)17-13(18)8-12(14(17)19)16-11-6-7-20-15(3,4)9-11/h10-12,16H,5-9H2,1-4H3.
What are the key properties of 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione?
1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione has a molecular weight of 282.38 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione is sourced from PubChem (CID 83033573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).