C15H26N2O3 — CID 83033573
1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione (PubChem CID 83033573) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 83033573 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-butan-2-yl-3-[(2,2-dimethyloxan-4-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CCC(C)N1C(=O)CC(NC2CCOC(C)(C)C2)C1=O |
| InChI | InChI=1S/C15H26N2O3/c1-5-10(2)17-13(18)8-12(14(17)19)16-11-6-7-20-15(3,4)9-11/h10-12,16H,5-9H2,1-4H3 |
| InChIKey | UXRGWGIIWGGQHC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|