C17H33NO — CID 83044983
N-[2-(3,3,5-trimethylcyclohexyl)oxypentyl]cyclopropanamine (PubChem CID 83044983) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is N-[2-(3,3,5-trimethylcyclohexyl)oxypentyl]cyclopropanamine.
| Compound Name | N-[2-(3,3,5-trimethylcyclohexyl)oxypentyl]cyclopropanamine |
|---|---|
| PubChem CID | 83044983 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | N-[2-(3,3,5-trimethylcyclohexyl)oxypentyl]cyclopropanamine |
| SMILES | CCCC(CNC1CC1)OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H33NO/c1-5-6-15(12-18-14-7-8-14)19-16-9-13(2)10-17(3,4)11-16/h13-16,18H,5-12H2,1-4H3 |
| InChIKey | RWHXPQVHVMICKB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |