C14H28N2O — CID 43368865
3-(3,3,5-trimethylcyclohexyl)oxypentanimidamide (PubChem CID 43368865) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-(3,3,5-trimethylcyclohexyl)oxypentanimidamide.
| Compound Name | 3-(3,3,5-trimethylcyclohexyl)oxypentanimidamide |
|---|---|
| PubChem CID | 43368865 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 3-(3,3,5-trimethylcyclohexyl)oxypentanimidamide |
| SMILES | [H]/N=C(\N)CC(CC)OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28N2O/c1-5-11(7-13(15)16)17-12-6-10(2)8-14(3,4)9-12/h10-12H,5-9H2,1-4H3,(H3,15,16) |
| InChIKey | BEFPAHMUUZGCTA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|