C14H29NO — CID 62457350
3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybutan-1-amine (PubChem CID 62457350) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybutan-1-amine.
| Compound Name | 3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybutan-1-amine |
|---|---|
| PubChem CID | 62457350 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybutan-1-amine |
| SMILES | CC1CC(OC(CN)C(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H29NO/c1-10(2)13(9-15)16-12-6-11(3)7-14(4,5)8-12/h10-13H,6-9,15H2,1-5H3 |
| InChIKey | GLHTUWHVTCMETK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |