C13H23BrCl2O — CID 114773351
3-(3-bromo-1,4-dichlorobutan-2-yl)oxy-1,1,5-trimethylcyclohexane (PubChem CID 114773351) has the molecular formula C13H23BrCl2O and a molecular weight of 346.14 g/mol. Its IUPAC name is 3-(3-bromo-1,4-dichlorobutan-2-yl)oxy-1,1,5-trimethylcyclohexane.
| Compound Name | 3-(3-bromo-1,4-dichlorobutan-2-yl)oxy-1,1,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 114773351 |
| Molecular Formula | C13H23BrCl2O |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 3-(3-bromo-1,4-dichlorobutan-2-yl)oxy-1,1,5-trimethylcyclohexane |
| SMILES | CC1CC(OC(CCl)C(Br)CCl)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23BrCl2O/c1-9-4-10(6-13(2,3)5-9)17-12(8-16)11(14)7-15/h9-12H,4-8H2,1-3H3 |
| InChIKey | NQTDJCMTMNRPOF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|