C15H25NOS — CID 55020997
2-thiophen-2-yl-2-(3,3,5-trimethylcyclohexyl)oxyethanamine (PubChem CID 55020997) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-thiophen-2-yl-2-(3,3,5-trimethylcyclohexyl)oxyethanamine.
| Compound Name | 2-thiophen-2-yl-2-(3,3,5-trimethylcyclohexyl)oxyethanamine |
|---|---|
| PubChem CID | 55020997 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-thiophen-2-yl-2-(3,3,5-trimethylcyclohexyl)oxyethanamine |
| SMILES | CC1CC(OC(CN)c2cccs2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H25NOS/c1-11-7-12(9-15(2,3)8-11)17-13(10-16)14-5-4-6-18-14/h4-6,11-13H,7-10,16H2,1-3H3 |
| InChIKey | OIMITZBGYRBBSJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |