C12H23N3 — CID 83045319
2-(3,5-dimethylpyrazol-1-yl)-N-ethylpentan-1-amine (PubChem CID 83045319) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-ethylpentan-1-amine.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-ethylpentan-1-amine |
|---|---|
| PubChem CID | 83045319 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-ethylpentan-1-amine |
| SMILES | CCCC(CNCC)n1nc(C)cc1C |
| InChI | InChI=1S/C12H23N3/c1-5-7-12(9-13-6-2)15-11(4)8-10(3)14-15/h8,12-13H,5-7,9H2,1-4H3 |
| InChIKey | TYXCVFWIDODFNQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |