C22H38N4S — CID 102596428
1-[2-decylsulfanyl-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3,5-dimethylpyrazole (PubChem CID 102596428) has the molecular formula C22H38N4S and a molecular weight of 390.64 g/mol. Its IUPAC name is 1-[2-decylsulfanyl-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3,5-dimethylpyrazole.
| Compound Name | 1-[2-decylsulfanyl-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 102596428 |
| Molecular Formula | C22H38N4S |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 1-[2-decylsulfanyl-1-(3,5-dimethylpyrazol-1-yl)ethyl]-3,5-dimethylpyrazole |
| SMILES | CCCCCCCCCCSCC(n1nc(C)cc1C)n1nc(C)cc1C |
| InChI | InChI=1S/C22H38N4S/c1-6-7-8-9-10-11-12-13-14-27-17-22(25-20(4)15-18(2)23-25)26-21(5)16-19(3)24-26/h15-16,22H,6-14,17H2,1-5H3 |
| InChIKey | BOGSIBWABZNECR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|