C16H34N2 — CID 176922404
butane;hexane;1,3,5-trimethylpyrazole (PubChem CID 176922404) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is butane;hexane;1,3,5-trimethylpyrazole.
| Compound Name | butane;hexane;1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 176922404 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | butane;hexane;1,3,5-trimethylpyrazole |
| SMILES | CCCC.CCCCCC.Cc1cc(C)n(C)n1 |
| InChI | InChI=1S/C6H10N2.C6H14.C4H10/c1-5-4-6(2)8(3)7-5;1-3-5-6-4-2;1-3-4-2/h4H,1-3H3;3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | KLEXGUUBTHDWGD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|