C12H22N2 — CID 143472478
5-heptan-4-yl-1,3-dimethylpyrazole (PubChem CID 143472478) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-heptan-4-yl-1,3-dimethylpyrazole.
| Compound Name | 5-heptan-4-yl-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 143472478 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5-heptan-4-yl-1,3-dimethylpyrazole |
| SMILES | CCCC(CCC)c1cc(C)nn1C |
| InChI | InChI=1S/C12H22N2/c1-5-7-11(8-6-2)12-9-10(3)13-14(12)4/h9,11H,5-8H2,1-4H3 |
| InChIKey | MZNFKLCJDCSUEH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |