C11H22N2 — CID 143472504
pentane;1,3,5-trimethylpyrazole (PubChem CID 143472504) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is pentane;1,3,5-trimethylpyrazole.
| Compound Name | pentane;1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 143472504 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | pentane;1,3,5-trimethylpyrazole |
| SMILES | CCCCC.Cc1cc(C)n(C)n1 |
| InChI | InChI=1S/C6H10N2.C5H12/c1-5-4-6(2)8(3)7-5;1-3-5-4-2/h4H,1-3H3;3-5H2,1-2H3 |
| InChIKey | BISDFFSRXBYDGT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |