C16H33N — CID 83050598
N-propyl-1-(2,4,4-trimethylcyclohexyl)butan-1-amine (PubChem CID 83050598) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is N-propyl-1-(2,4,4-trimethylcyclohexyl)butan-1-amine.
| Compound Name | N-propyl-1-(2,4,4-trimethylcyclohexyl)butan-1-amine |
|---|---|
| PubChem CID | 83050598 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | N-propyl-1-(2,4,4-trimethylcyclohexyl)butan-1-amine |
| SMILES | CCCNC(CCC)C1CCC(C)(C)CC1C |
| InChI | InChI=1S/C16H33N/c1-6-8-15(17-11-7-2)14-9-10-16(4,5)12-13(14)3/h13-15,17H,6-12H2,1-5H3 |
| InChIKey | QSYUBISDZJDRTD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |