C15H24N4 — CID 83055860
3-[(2-propylpiperidin-1-yl)methyl]pyridine-2-carboximidamide (PubChem CID 83055860) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-[(2-propylpiperidin-1-yl)methyl]pyridine-2-carboximidamide.
| Compound Name | 3-[(2-propylpiperidin-1-yl)methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 83055860 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3-[(2-propylpiperidin-1-yl)methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1CN1CCCCC1CCC |
| InChI | InChI=1S/C15H24N4/c1-2-6-13-8-3-4-10-19(13)11-12-7-5-9-18-14(12)15(16)17/h5,7,9,13H,2-4,6,8,10-11H2,1H3,(H3,16,17) |
| InChIKey | SLYIHPVUJQYXSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|