C8H15BrF3NO2S — CID 83058117
N-(3-bromobutyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83058117) has the molecular formula C8H15BrF3NO2S and a molecular weight of 326.18 g/mol. Its IUPAC name is N-(3-bromobutyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(3-bromobutyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83058117 |
| Molecular Formula | C8H15BrF3NO2S |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | N-(3-bromobutyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(Br)CCNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H15BrF3NO2S/c1-7(9)3-5-13-16(14,15)6-2-4-8(10,11)12/h7,13H,2-6H2,1H3 |
| InChIKey | DWHVKAFWFZAIGM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|