C9H17BrF3NO2S — CID 83058816
N-(4-bromo-2-methylbutyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83058816) has the molecular formula C9H17BrF3NO2S and a molecular weight of 340.21 g/mol. Its IUPAC name is N-(4-bromo-2-methylbutyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(4-bromo-2-methylbutyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83058816 |
| Molecular Formula | C9H17BrF3NO2S |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(4-bromo-2-methylbutyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(CCBr)CNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H17BrF3NO2S/c1-8(3-5-10)7-14-17(15,16)6-2-4-9(11,12)13/h8,14H,2-7H2,1H3 |
| InChIKey | BPDDNUYNEQAZRR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|