C14H14ClF2NO3 — CID 83059029
1-(2-chloro-4,5-difluorobenzoyl)-2-ethylpyrrolidine-2-carboxylic acid (PubChem CID 83059029) has the molecular formula C14H14ClF2NO3 and a molecular weight of 317.72 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorobenzoyl)-2-ethylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-chloro-4,5-difluorobenzoyl)-2-ethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83059029 |
| Molecular Formula | C14H14ClF2NO3 |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-(2-chloro-4,5-difluorobenzoyl)-2-ethylpyrrolidine-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN1C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H14ClF2NO3/c1-2-14(13(20)21)4-3-5-18(14)12(19)8-6-10(16)11(17)7-9(8)15/h6-7H,2-5H2,1H3,(H,20,21) |
| InChIKey | GGUPPZBEXLEEBC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|