C15H18FNO3 — CID 83075485
2-ethyl-1-(2-fluoro-3-methylbenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 83075485) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-ethyl-1-(2-fluoro-3-methylbenzoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethyl-1-(2-fluoro-3-methylbenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83075485 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-ethyl-1-(2-fluoro-3-methylbenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN1C(=O)c1cccc(C)c1F |
| InChI | InChI=1S/C15H18FNO3/c1-3-15(14(19)20)8-5-9-17(15)13(18)11-7-4-6-10(2)12(11)16/h4,6-7H,3,5,8-9H2,1-2H3,(H,19,20) |
| InChIKey | BBLJDZIGLQNWHM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |