C10H16F3NO5S — CID 83067807
2-[4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]acetic acid (PubChem CID 83067807) has the molecular formula C10H16F3NO5S and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-[4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 83067807 |
| Molecular Formula | C10H16F3NO5S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(S(=O)(=O)CCCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C10H16F3NO5S/c11-10(12,13)2-1-5-20(17,18)14-3-4-19-8(7-14)6-9(15)16/h8H,1-7H2,(H,15,16) |
| InChIKey | KRKLUMMYESXLCR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |