About Edrophonium Chloride
Edrophonium Chloride (PubChem CID 8307) has the molecular formula C10H16ClNO
and a molecular weight of 201.69 g/mol. Its IUPAC name is ethyl-(3-hydroxyphenyl)-dimethylazanium chloride.
Molecular Properties
| Compound Name | Edrophonium Chloride |
| PubChem CID | 8307 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.69 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | ethyl-(3-hydroxyphenyl)-dimethylazanium chloride |
| SMILES | CC[N+](C)(C)C1=CC(=CC=C1)O.[Cl-] |
| InChI | InChI=1S/C10H15NO.ClH/c1-4-11(2,3)9-6-5-7-10(12)8-9;/h5-8H,4H2,1-3H3;1H |
| InChIKey | BXKDSDJJOVIHMX-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 145 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Edrophonium Chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Edrophonium Chloride?
The IUPAC name of Edrophonium Chloride (CID 8307) is ethyl-(3-hydroxyphenyl)-dimethylazanium chloride.
What is the SMILES notation for Edrophonium Chloride?
The canonical SMILES for Edrophonium Chloride is CC[N+](C)(C)C1=CC(=CC=C1)O.[Cl-].
What is the InChIKey of Edrophonium Chloride?
The InChIKey is BXKDSDJJOVIHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.ClH/c1-4-11(2,3)9-6-5-7-10(12)8-9;/h5-8H,4H2,1-3H3;1H.
What are the key properties of Edrophonium Chloride?
Edrophonium Chloride has a molecular weight of 201.69 g/mol, XLogP of not available, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Edrophonium Chloride is sourced from PubChem (CID 8307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).