About 3-(diethylamino)phenol
3-(diethylamino)phenol (PubChem CID 7062) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-(diethylamino)phenol.
Molecular Properties
| Compound Name | 3-(diethylamino)phenol |
| PubChem CID | 7062 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-(diethylamino)phenol |
| SMILES | CCN(CC)c1cccc(O)c1 |
| InChI | InChI=1S/C10H15NO/c1-3-11(4-2)9-6-5-7-10(12)8-9/h5-8,12H,3-4H2,1-2H3 |
| InChIKey | WAVOOWVINKGEHS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(diethylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)phenol?
The IUPAC name of 3-(diethylamino)phenol (CID 7062) is 3-(diethylamino)phenol.
What is the SMILES notation for 3-(diethylamino)phenol?
The canonical SMILES for 3-(diethylamino)phenol is CCN(CC)c1cccc(O)c1.
What is the InChIKey of 3-(diethylamino)phenol?
The InChIKey is WAVOOWVINKGEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-3-11(4-2)9-6-5-7-10(12)8-9/h5-8,12H,3-4H2,1-2H3.
What are the key properties of 3-(diethylamino)phenol?
3-(diethylamino)phenol has a molecular weight of 165.24 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)phenol is sourced from PubChem (CID 7062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).