C10H14N2O2S — CID 83071091
2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 83071091) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83071091 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN1c1nccs1 |
| InChI | InChI=1S/C10H14N2O2S/c1-2-10(8(13)14)4-3-6-12(10)9-11-5-7-15-9/h5,7H,2-4,6H2,1H3,(H,13,14) |
| InChIKey | PDDBQHYKNFKWNV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |