2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid

C10H14N2O2S — CID 83071091

IUPAC2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid
SMILESCCC1(C(=O)O)CCCN1c1nccs1
InChIInChI=1S/C10H14N2O2S/c1-2-10(8(13)14)4-3-6-12(10)9-11-5-7-15-9/h5,7H,2-4,6H2,1H3,(H,13,14)
InChIKeyPDDBQHYKNFKWNV-UHFFFAOYSA-N
MW226.30 g/mol
LogP1.98
Rot. Bonds3

About 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid

2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 83071091) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid
PubChem CID83071091
Molecular FormulaC10H14N2O2S
Molecular Weight226.30 g/mol
Exact Mass226.08
IUPAC Name2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid
SMILESCCC1(C(=O)O)CCCN1c1nccs1
InChIInChI=1S/C10H14N2O2S/c1-2-10(8(13)14)4-3-6-12(10)9-11-5-7-15-9/h5,7H,2-4,6H2,1H3,(H,13,14)
InChIKeyPDDBQHYKNFKWNV-UHFFFAOYSA-N
XLogP1.98
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.30
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid (CID 83071091) is 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid is CCC1(C(=O)O)CCCN1c1nccs1.
What is the InChIKey of 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid?
The InChIKey is PDDBQHYKNFKWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-2-10(8(13)14)4-3-6-12(10)9-11-5-7-15-9/h5,7H,2-4,6H2,1H3,(H,13,14).
What are the key properties of 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid?
2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid has a molecular weight of 226.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 83071091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).