C13H5Cl3F2N2S — CID 83074467
5,6-dichloro-3-(2-chloro-4,6-difluorophenyl)-1H-benzimidazole-2-thione (PubChem CID 83074467) has the molecular formula C13H5Cl3F2N2S and a molecular weight of 365.62 g/mol. Its IUPAC name is 5,6-dichloro-3-(2-chloro-4,6-difluorophenyl)-1H-benzimidazole-2-thione.
| Compound Name | 5,6-dichloro-3-(2-chloro-4,6-difluorophenyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 83074467 |
| Molecular Formula | C13H5Cl3F2N2S |
| Molecular Weight | 365.62 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 5,6-dichloro-3-(2-chloro-4,6-difluorophenyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1cc(F)c(-n2c(=S)[nH]c3cc(Cl)c(Cl)cc32)c(Cl)c1 |
| InChI | InChI=1S/C13H5Cl3F2N2S/c14-6-3-10-11(4-7(6)15)20(13(21)19-10)12-8(16)1-5(17)2-9(12)18/h1-4H,(H,19,21) |
| InChIKey | YGYFTGXTUBEHSN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|