C11H15N3O3S — CID 83074911
2-ethyl-1-(4-methylthiadiazole-5-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 83074911) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-ethyl-1-(4-methylthiadiazole-5-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethyl-1-(4-methylthiadiazole-5-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83074911 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-ethyl-1-(4-methylthiadiazole-5-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN1C(=O)c1snnc1C |
| InChI | InChI=1S/C11H15N3O3S/c1-3-11(10(16)17)5-4-6-14(11)9(15)8-7(2)12-13-18-8/h3-6H2,1-2H3,(H,16,17) |
| InChIKey | ABHABUFDCASRCH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |