C8H12F3NO4S — CID 83075818
2-ethyl-1-(trifluoromethylsulfonyl)pyrrolidine-2-carboxylic acid (PubChem CID 83075818) has the molecular formula C8H12F3NO4S and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-ethyl-1-(trifluoromethylsulfonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethyl-1-(trifluoromethylsulfonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83075818 |
| Molecular Formula | C8H12F3NO4S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-ethyl-1-(trifluoromethylsulfonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO4S/c1-2-7(6(13)14)4-3-5-12(7)17(15,16)8(9,10)11/h2-5H2,1H3,(H,13,14) |
| InChIKey | OHMMEYHVHFIELP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |