C14H18ClN3 — CID 83076603
2-chloro-6-[(2,2-dimethylcyclohexyl)amino]pyridine-4-carbonitrile (PubChem CID 83076603) has the molecular formula C14H18ClN3 and a molecular weight of 263.77 g/mol. Its IUPAC name is 2-chloro-6-[(2,2-dimethylcyclohexyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(2,2-dimethylcyclohexyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83076603 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-chloro-6-[(2,2-dimethylcyclohexyl)amino]pyridine-4-carbonitrile |
| SMILES | CC1(C)CCCCC1Nc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C14H18ClN3/c1-14(2)6-4-3-5-11(14)17-13-8-10(9-16)7-12(15)18-13/h7-8,11H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | NOQUAIYHHZUJPC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|