C16H14Cl2FN — CID 83077048
2,6-dichloro-N-[(2-cyclopropylphenyl)methyl]-4-fluoroaniline (PubChem CID 83077048) has the molecular formula C16H14Cl2FN and a molecular weight of 310.20 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2-cyclopropylphenyl)methyl]-4-fluoroaniline.
| Compound Name | 2,6-dichloro-N-[(2-cyclopropylphenyl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 83077048 |
| Molecular Formula | C16H14Cl2FN |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2,6-dichloro-N-[(2-cyclopropylphenyl)methyl]-4-fluoroaniline |
| SMILES | Fc1cc(Cl)c(NCc2ccccc2C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2FN/c17-14-7-12(19)8-15(18)16(14)20-9-11-3-1-2-4-13(11)10-5-6-10/h1-4,7-8,10,20H,5-6,9H2 |
| InChIKey | FZVUMVIMEGMMFD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |