C14H11ClF3N — CID 6426036
2-chloro-4-(3,5-difluorophenyl)-N-ethyl-6-fluoroaniline (PubChem CID 6426036) has the molecular formula C14H11ClF3N and a molecular weight of 285.70 g/mol. Its IUPAC name is 2-chloro-4-(3,5-difluorophenyl)-N-ethyl-6-fluoroaniline.
| Compound Name | 2-chloro-4-(3,5-difluorophenyl)-N-ethyl-6-fluoroaniline |
|---|---|
| PubChem CID | 6426036 |
| Molecular Formula | C14H11ClF3N |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-chloro-4-(3,5-difluorophenyl)-N-ethyl-6-fluoroaniline |
| SMILES | CCNc1c(F)cc(-c2cc(F)cc(F)c2)cc1Cl |
| InChI | InChI=1S/C14H11ClF3N/c1-2-19-14-12(15)5-9(6-13(14)18)8-3-10(16)7-11(17)4-8/h3-7,19H,2H2,1H3 |
| InChIKey | DHBMORNIVSRWLM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |