C13H13Cl2FN2OS — CID 83078579
1-carbamothioyl-N-(2,6-dichloro-4-fluorophenyl)-3-methylcyclobutane-1-carboxamide (PubChem CID 83078579) has the molecular formula C13H13Cl2FN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,6-dichloro-4-fluorophenyl)-3-methylcyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,6-dichloro-4-fluorophenyl)-3-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 83078579 |
| Molecular Formula | C13H13Cl2FN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 1-carbamothioyl-N-(2,6-dichloro-4-fluorophenyl)-3-methylcyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)Nc2c(Cl)cc(F)cc2Cl)(C(N)=S)C1 |
| InChI | InChI=1S/C13H13Cl2FN2OS/c1-6-4-13(5-6,11(17)20)12(19)18-10-8(14)2-7(16)3-9(10)15/h2-3,6H,4-5H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | YWWXFUUKYGHSGX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|