C15H19ClN2OS — CID 80589204
1-carbamothioyl-N-[2-(4-chlorophenyl)ethyl]-3-methylcyclobutane-1-carboxamide (PubChem CID 80589204) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is 1-carbamothioyl-N-[2-(4-chlorophenyl)ethyl]-3-methylcyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[2-(4-chlorophenyl)ethyl]-3-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80589204 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-carbamothioyl-N-[2-(4-chlorophenyl)ethyl]-3-methylcyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NCCc2ccc(Cl)cc2)(C(N)=S)C1 |
| InChI | InChI=1S/C15H19ClN2OS/c1-10-8-15(9-10,13(17)20)14(19)18-7-6-11-2-4-12(16)5-3-11/h2-5,10H,6-9H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | WSJTXFYDSWQOPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|