C11H16N4OS — CID 80589727
1-carbamothioyl-3-methyl-N-(1H-pyrazol-4-ylmethyl)cyclobutane-1-carboxamide (PubChem CID 80589727) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-carbamothioyl-3-methyl-N-(1H-pyrazol-4-ylmethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-3-methyl-N-(1H-pyrazol-4-ylmethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80589727 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-carbamothioyl-3-methyl-N-(1H-pyrazol-4-ylmethyl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NCc2cn[nH]c2)(C(N)=S)C1 |
| InChI | InChI=1S/C11H16N4OS/c1-7-2-11(3-7,9(12)17)10(16)13-4-8-5-14-15-6-8/h5-7H,2-4H2,1H3,(H2,12,17)(H,13,16)(H,14,15) |
| InChIKey | AATCQHLQTMGYRW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|