C13H17N5OS — CID 83082277
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082277) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082277 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(=O)N1c2ccccc2CC1C |
| InChI | InChI=1S/C13H17N5OS/c1-8-6-9-4-2-3-5-10(9)18(8)11(19)7-20-13(16)17-12(14)15/h2-5,8H,6-7H2,1H3,(H5,14,15,16,17) |
| InChIKey | NPANXIWQJKAVOB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|