C8H10BrNO4S2 — CID 83083626
3-(bromomethylsulfonylamino)-3-thiophen-2-ylpropanoic acid (PubChem CID 83083626) has the molecular formula C8H10BrNO4S2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-(bromomethylsulfonylamino)-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(bromomethylsulfonylamino)-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 83083626 |
| Molecular Formula | C8H10BrNO4S2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | 3-(bromomethylsulfonylamino)-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)CBr)c1cccs1 |
| InChI | InChI=1S/C8H10BrNO4S2/c9-5-16(13,14)10-6(4-8(11)12)7-2-1-3-15-7/h1-3,6,10H,4-5H2,(H,11,12) |
| InChIKey | PNAIMHDRMNBLGG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|