C15H26N2O3 — CID 83093839
ethyl 2-[(3-tert-butyl-1-methylpyrazol-4-yl)-hydroxymethyl]butanoate (PubChem CID 83093839) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is ethyl 2-[(3-tert-butyl-1-methylpyrazol-4-yl)-hydroxymethyl]butanoate.
| Compound Name | ethyl 2-[(3-tert-butyl-1-methylpyrazol-4-yl)-hydroxymethyl]butanoate |
|---|---|
| PubChem CID | 83093839 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | ethyl 2-[(3-tert-butyl-1-methylpyrazol-4-yl)-hydroxymethyl]butanoate |
| SMILES | CCOC(=O)C(CC)C(O)c1cn(C)nc1C(C)(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-7-10(14(19)20-8-2)12(18)11-9-17(6)16-13(11)15(3,4)5/h9-10,12,18H,7-8H2,1-6H3 |
| InChIKey | UTCZXWFKORLAPR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |