C15H23N3O2S — CID 83098163
4-(2-amino-1-thiophen-2-ylpropyl)-N-cyclopropylmorpholine-3-carboxamide (PubChem CID 83098163) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-(2-amino-1-thiophen-2-ylpropyl)-N-cyclopropylmorpholine-3-carboxamide.
| Compound Name | 4-(2-amino-1-thiophen-2-ylpropyl)-N-cyclopropylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098163 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-(2-amino-1-thiophen-2-ylpropyl)-N-cyclopropylmorpholine-3-carboxamide |
| SMILES | CC(N)C(c1cccs1)N1CCOCC1C(=O)NC1CC1 |
| InChI | InChI=1S/C15H23N3O2S/c1-10(16)14(13-3-2-8-21-13)18-6-7-20-9-12(18)15(19)17-11-4-5-11/h2-3,8,10-12,14H,4-7,9,16H2,1H3,(H,17,19) |
| InChIKey | IDDOJEFAZUNBCI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |