C14H19Cl2N3O2 — CID 83098821
4-[(3,6-dichloro-2-pyridinyl)methyl]-N-propylmorpholine-3-carboxamide (PubChem CID 83098821) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-[(3,6-dichloro-2-pyridinyl)methyl]-N-propylmorpholine-3-carboxamide.
| Compound Name | 4-[(3,6-dichloro-2-pyridinyl)methyl]-N-propylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098821 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-[(3,6-dichloro-2-pyridinyl)methyl]-N-propylmorpholine-3-carboxamide |
| SMILES | CCCNC(=O)C1COCCN1Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O2/c1-2-5-17-14(20)12-9-21-7-6-19(12)8-11-10(15)3-4-13(16)18-11/h3-4,12H,2,5-9H2,1H3,(H,17,20) |
| InChIKey | MJVFUWSCXXIKHM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|