C13H17Cl2N3O2 — CID 106993901
4-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylmorpholine-3-carboxamide (PubChem CID 106993901) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylmorpholine-3-carboxamide.
| Compound Name | 4-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 106993901 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylmorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-2-16-13(19)10-8-20-6-5-18(10)7-9-3-4-11(14)17-12(9)15/h3-4,10H,2,5-8H2,1H3,(H,16,19) |
| InChIKey | YCPPOJMQVYWDFY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|