C14H22N4O2 — CID 83103290
N-ethyl-4-[[2-(methylamino)-3-pyridinyl]methyl]morpholine-3-carboxamide (PubChem CID 83103290) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-ethyl-4-[[2-(methylamino)-3-pyridinyl]methyl]morpholine-3-carboxamide.
| Compound Name | N-ethyl-4-[[2-(methylamino)-3-pyridinyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83103290 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-ethyl-4-[[2-(methylamino)-3-pyridinyl]methyl]morpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1Cc1cccnc1NC |
| InChI | InChI=1S/C14H22N4O2/c1-3-16-14(19)12-10-20-8-7-18(12)9-11-5-4-6-17-13(11)15-2/h4-6,12H,3,7-10H2,1-2H3,(H,15,17)(H,16,19) |
| InChIKey | XNRGLGMJNFGDLB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |