C12H16ClN3O3S — CID 83100280
4-(4-chloro-5-formyl-1,3-thiazol-2-yl)-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 83100280) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is 4-(4-chloro-5-formyl-1,3-thiazol-2-yl)-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-(4-chloro-5-formyl-1,3-thiazol-2-yl)-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83100280 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-(4-chloro-5-formyl-1,3-thiazol-2-yl)-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1COCCN1c1nc(Cl)c(C=O)s1 |
| InChI | InChI=1S/C12H16ClN3O3S/c1-7(2)14-11(18)8-6-19-4-3-16(8)12-15-10(13)9(5-17)20-12/h5,7-8H,3-4,6H2,1-2H3,(H,14,18) |
| InChIKey | KNBVOFLNLZLOOQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|