C9H10ClN3O3S — CID 83096652
4-(4-chloro-5-formyl-1,3-thiazol-2-yl)morpholine-3-carboxamide (PubChem CID 83096652) has the molecular formula C9H10ClN3O3S and a molecular weight of 275.72 g/mol. Its IUPAC name is 4-(4-chloro-5-formyl-1,3-thiazol-2-yl)morpholine-3-carboxamide.
| Compound Name | 4-(4-chloro-5-formyl-1,3-thiazol-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83096652 |
| Molecular Formula | C9H10ClN3O3S |
| Molecular Weight | 275.72 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 4-(4-chloro-5-formyl-1,3-thiazol-2-yl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1c1nc(Cl)c(C=O)s1 |
| InChI | InChI=1S/C9H10ClN3O3S/c10-7-6(3-14)17-9(12-7)13-1-2-16-4-5(13)8(11)15/h3,5H,1-2,4H2,(H2,11,15) |
| InChIKey | GLOYJKAOEAHILT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.72 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|