C10H12N2O4S — CID 83095887
5-(3-carbamoylmorpholin-4-yl)thiophene-2-carboxylic acid (PubChem CID 83095887) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-(3-carbamoylmorpholin-4-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-(3-carbamoylmorpholin-4-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 83095887 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-(3-carbamoylmorpholin-4-yl)thiophene-2-carboxylic acid |
| SMILES | NC(=O)C1COCCN1c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C10H12N2O4S/c11-9(13)6-5-16-4-3-12(6)8-2-1-7(17-8)10(14)15/h1-2,6H,3-5H2,(H2,11,13)(H,14,15) |
| InChIKey | SMEAFKXFDSMJML-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |